ChemNet > CAS > 175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid
175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid
| Produkt-Name |
3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid |
| Synonyme |
3-[2-[(4-Chlorophenyl)thio]-5-nitrophenyl]acrylic acid; (2Z)-3-{2-[(4-chlorophenyl)sulfanyl]-5-nitrophenyl}prop-2-enoic acid |
| Molekulare Formel |
C15H10ClNO4S |
| Molecular Weight |
335.7622 |
| InChI |
InChI=1/C15H10ClNO4S/c16-11-2-5-13(6-3-11)22-14-7-4-12(17(20)21)9-10(14)1-8-15(18)19/h1-9H,(H,18,19)/b8-1- |
| CAS Registry Number |
175278-51-0 |
| Molecular Structure |
![175278-51-0 3-{2-[(4-chlorophenyl)thio]-5-nitrophenyl}acrylic acid](https://images-a.chemnet.com/suppliers/chembase/309/30947.gif)
|
| Dichte |
1.5g/cm3 |
| Schmelzpunkt |
212℃ |
| Siedepunkt |
531.7°C at 760 mmHg |
| Brechungsindex |
1.694 |
| Flammpunkt |
275.4°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
